ethane;4-ethoxy-3-methyl-4-oxobutanoic acid

C9H18O4 — CID 122506118

IUPACethane;4-ethoxy-3-methyl-4-oxobutanoic acid
SMILESCC.CCOC(=O)C(C)CC(=O)O
InChIInChI=1S/C7H12O4.C2H6/c1-3-11-7(10)5(2)4-6(8)9;1-2/h5H,3-4H2,1-2H3,(H,8,9);1-2H3
InChIKeyQUOOKSNCSUEXHH-UHFFFAOYSA-N
MW190.24 g/mol
LogP1.69
Rot. Bonds4

About ethane;4-ethoxy-3-methyl-4-oxobutanoic acid

ethane;4-ethoxy-3-methyl-4-oxobutanoic acid (PubChem CID 122506118) has the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. Its IUPAC name is ethane;4-ethoxy-3-methyl-4-oxobutanoic acid.

Molecular Properties

Compound Nameethane;4-ethoxy-3-methyl-4-oxobutanoic acid
PubChem CID122506118
Molecular FormulaC9H18O4
Molecular Weight190.24 g/mol
Exact Mass190.12
IUPAC Nameethane;4-ethoxy-3-methyl-4-oxobutanoic acid
SMILESCC.CCOC(=O)C(C)CC(=O)O
InChIInChI=1S/C7H12O4.C2H6/c1-3-11-7(10)5(2)4-6(8)9;1-2/h5H,3-4H2,1-2H3,(H,8,9);1-2H3
InChIKeyQUOOKSNCSUEXHH-UHFFFAOYSA-N
XLogP1.69
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.24
LogP ≤ 51.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze ethane;4-ethoxy-3-methyl-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;4-ethoxy-3-methyl-4-oxobutanoic acid?
The IUPAC name of ethane;4-ethoxy-3-methyl-4-oxobutanoic acid (CID 122506118) is ethane;4-ethoxy-3-methyl-4-oxobutanoic acid.
What is the SMILES notation for ethane;4-ethoxy-3-methyl-4-oxobutanoic acid?
The canonical SMILES for ethane;4-ethoxy-3-methyl-4-oxobutanoic acid is CC.CCOC(=O)C(C)CC(=O)O.
What is the InChIKey of ethane;4-ethoxy-3-methyl-4-oxobutanoic acid?
The InChIKey is QUOOKSNCSUEXHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4.C2H6/c1-3-11-7(10)5(2)4-6(8)9;1-2/h5H,3-4H2,1-2H3,(H,8,9);1-2H3.
What are the key properties of ethane;4-ethoxy-3-methyl-4-oxobutanoic acid?
ethane;4-ethoxy-3-methyl-4-oxobutanoic acid has a molecular weight of 190.24 g/mol, XLogP of 1.69, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethoxy-3-methyl-4-oxobutanoic acid is sourced from PubChem (CID 122506118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).