C13H22O6 — CID 59867004
6-ethoxy-3-ethoxycarbonyl-2,5-dimethyl-6-oxohexanoic acid (PubChem CID 59867004) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is 6-ethoxy-3-ethoxycarbonyl-2,5-dimethyl-6-oxohexanoic acid.
| Compound Name | 6-ethoxy-3-ethoxycarbonyl-2,5-dimethyl-6-oxohexanoic acid |
|---|---|
| PubChem CID | 59867004 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 6-ethoxy-3-ethoxycarbonyl-2,5-dimethyl-6-oxohexanoic acid |
| SMILES | CCOC(=O)C(C)CC(C(=O)OCC)C(C)C(=O)O |
| InChI | InChI=1S/C13H22O6/c1-5-18-12(16)8(3)7-10(9(4)11(14)15)13(17)19-6-2/h8-10H,5-7H2,1-4H3,(H,14,15) |
| InChIKey | OLVAPUJGCZEEIL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |