C19H26ClNO6 — CID 134849780
diethyl 2-[(R)-(2-chlorophenyl)-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]propanedioate (PubChem CID 134849780) has the molecular formula C19H26ClNO6 and a molecular weight of 399.87 g/mol. Its IUPAC name is diethyl 2-[(R)-(2-chlorophenyl)-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]propanedioate.
| Compound Name | diethyl 2-[(R)-(2-chlorophenyl)-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]propanedioate |
|---|---|
| PubChem CID | 134849780 |
| Molecular Formula | C19H26ClNO6 |
| Molecular Weight | 399.87 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | diethyl 2-[(R)-(2-chlorophenyl)-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H](NC(=O)OC(C)(C)C)c1ccccc1Cl |
| InChI | InChI=1S/C19H26ClNO6/c1-6-25-16(22)14(17(23)26-7-2)15(12-10-8-9-11-13(12)20)21-18(24)27-19(3,4)5/h8-11,14-15H,6-7H2,1-5H3,(H,21,24)/t15-/m0/s1 |
| InChIKey | ORACIQZYKDXVSU-HNNXBMFYSA-N |
| XLogP | 3.65 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.87 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|