C23H25ClFNO5 — CID 135061873
ethyl (2S,3S)-2-benzoyl-3-(2-chlorophenyl)-2-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 135061873) has the molecular formula C23H25ClFNO5 and a molecular weight of 449.91 g/mol. Its IUPAC name is ethyl (2S,3S)-2-benzoyl-3-(2-chlorophenyl)-2-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | ethyl (2S,3S)-2-benzoyl-3-(2-chlorophenyl)-2-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 135061873 |
| Molecular Formula | C23H25ClFNO5 |
| Molecular Weight | 449.91 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | ethyl (2S,3S)-2-benzoyl-3-(2-chlorophenyl)-2-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CCOC(=O)[C@@](F)(C(=O)c1ccccc1)[C@@H](NC(=O)OC(C)(C)C)c1ccccc1Cl |
| InChI | InChI=1S/C23H25ClFNO5/c1-5-30-20(28)23(25,19(27)15-11-7-6-8-12-15)18(16-13-9-10-14-17(16)24)26-21(29)31-22(2,3)4/h6-14,18H,5H2,1-4H3,(H,26,29)/t18-,23-/m0/s1 |
| InChIKey | RTZCRCRXYTWRHE-MBSDFSHPSA-N |
| XLogP | 5.06 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.91 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|