C24H27F2NO5 — CID 135063819
ethyl (2R,3S)-2-fluoro-2-(4-fluorobenzoyl)-3-(4-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 135063819) has the molecular formula C24H27F2NO5 and a molecular weight of 447.48 g/mol. Its IUPAC name is ethyl (2R,3S)-2-fluoro-2-(4-fluorobenzoyl)-3-(4-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | ethyl (2R,3S)-2-fluoro-2-(4-fluorobenzoyl)-3-(4-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 135063819 |
| Molecular Formula | C24H27F2NO5 |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | ethyl (2R,3S)-2-fluoro-2-(4-fluorobenzoyl)-3-(4-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CCOC(=O)[C@](F)(C(=O)c1ccc(F)cc1)[C@@H](NC(=O)OC(C)(C)C)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H27F2NO5/c1-6-31-21(29)24(26,20(28)17-11-13-18(25)14-12-17)19(16-9-7-15(2)8-10-16)27-22(30)32-23(3,4)5/h7-14,19H,6H2,1-5H3,(H,27,30)/t19-,24+/m0/s1 |
| InChIKey | PELNEXOVHKJVIB-YADARESESA-N |
| XLogP | 4.85 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|