C17H24FNO3 — CID 146633642
tert-butyl N-[(1S)-1-(4-fluorophenyl)-4-oxohexyl]carbamate (PubChem CID 146633642) has the molecular formula C17H24FNO3 and a molecular weight of 309.38 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(4-fluorophenyl)-4-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(4-fluorophenyl)-4-oxohexyl]carbamate |
|---|---|
| PubChem CID | 146633642 |
| Molecular Formula | C17H24FNO3 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | tert-butyl N-[(1S)-1-(4-fluorophenyl)-4-oxohexyl]carbamate |
| SMILES | CCC(=O)CC[C@H](NC(=O)OC(C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H24FNO3/c1-5-14(20)10-11-15(12-6-8-13(18)9-7-12)19-16(21)22-17(2,3)4/h6-9,15H,5,10-11H2,1-4H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | UGUJTCFDLLQDQX-HNNXBMFYSA-N |
| XLogP | 4.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |