C14H18FNO3 — CID 87517923
tert-butyl N-[1-(4-fluorophenyl)-3-oxopropyl]carbamate (PubChem CID 87517923) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is tert-butyl N-[1-(4-fluorophenyl)-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[1-(4-fluorophenyl)-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 87517923 |
| Molecular Formula | C14H18FNO3 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | tert-butyl N-[1-(4-fluorophenyl)-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CC=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H18FNO3/c1-14(2,3)19-13(18)16-12(8-9-17)10-4-6-11(15)7-5-10/h4-7,9,12H,8H2,1-3H3,(H,16,18) |
| InChIKey | SKKQVMWQYKIFSU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|