C17H22FNO4 — CID 58900587
tert-butyl N-[2-acetyl-1-(4-fluorophenyl)-3-oxobutyl]carbamate (PubChem CID 58900587) has the molecular formula C17H22FNO4 and a molecular weight of 323.36 g/mol. Its IUPAC name is tert-butyl N-[2-acetyl-1-(4-fluorophenyl)-3-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[2-acetyl-1-(4-fluorophenyl)-3-oxobutyl]carbamate |
|---|---|
| PubChem CID | 58900587 |
| Molecular Formula | C17H22FNO4 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | tert-butyl N-[2-acetyl-1-(4-fluorophenyl)-3-oxobutyl]carbamate |
| SMILES | CC(=O)C(C(C)=O)C(NC(=O)OC(C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H22FNO4/c1-10(20)14(11(2)21)15(12-6-8-13(18)9-7-12)19-16(22)23-17(3,4)5/h6-9,14-15H,1-5H3,(H,19,22) |
| InChIKey | AOPQWESEMOTIDS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|