C13H18F2N2O2 — CID 175666923
tert-butyl N-[(1R)-1-(4-aminophenyl)-2,2-difluoroethyl]carbamate (PubChem CID 175666923) has the molecular formula C13H18F2N2O2 and a molecular weight of 272.30 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-(4-aminophenyl)-2,2-difluoroethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-(4-aminophenyl)-2,2-difluoroethyl]carbamate |
|---|---|
| PubChem CID | 175666923 |
| Molecular Formula | C13H18F2N2O2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | tert-butyl N-[(1R)-1-(4-aminophenyl)-2,2-difluoroethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](c1ccc(N)cc1)C(F)F |
| InChI | InChI=1S/C13H18F2N2O2/c1-13(2,3)19-12(18)17-10(11(14)15)8-4-6-9(16)7-5-8/h4-7,10-11H,16H2,1-3H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | IITXALLMFAMBKX-SNVBAGLBSA-N |
| XLogP | 3.10 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|