C15H25N3O3 — CID 83928424
tert-butyl N-[4-amino-1-(4-aminophenyl)-1-hydroxybutan-2-yl]carbamate (PubChem CID 83928424) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-(4-aminophenyl)-1-hydroxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-(4-aminophenyl)-1-hydroxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 83928424 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | tert-butyl N-[4-amino-1-(4-aminophenyl)-1-hydroxybutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCN)C(O)c1ccc(N)cc1 |
| InChI | InChI=1S/C15H25N3O3/c1-15(2,3)21-14(20)18-12(8-9-16)13(19)10-4-6-11(17)7-5-10/h4-7,12-13,19H,8-9,16-17H2,1-3H3,(H,18,20) |
| InChIKey | IFFVLBVZUGGVKN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|