C17H23NO3 — CID 71572812
tert-butyl N-(1-hydroxy-1-phenylhex-5-yn-2-yl)carbamate (PubChem CID 71572812) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is tert-butyl N-(1-hydroxy-1-phenylhex-5-yn-2-yl)carbamate.
| Compound Name | tert-butyl N-(1-hydroxy-1-phenylhex-5-yn-2-yl)carbamate |
|---|---|
| PubChem CID | 71572812 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | tert-butyl N-(1-hydroxy-1-phenylhex-5-yn-2-yl)carbamate |
| SMILES | C#CCCC(NC(=O)OC(C)(C)C)C(O)c1ccccc1 |
| InChI | InChI=1S/C17H23NO3/c1-5-6-12-14(18-16(20)21-17(2,3)4)15(19)13-10-8-7-9-11-13/h1,7-11,14-15,19H,6,12H2,2-4H3,(H,18,20) |
| InChIKey | GNBAHXDALHEPGP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|