C19H27NO3 — CID 123595256
tert-butyl N-(1-hydroxy-2-methyl-1-phenylhept-6-yn-3-yl)carbamate (PubChem CID 123595256) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is tert-butyl N-(1-hydroxy-2-methyl-1-phenylhept-6-yn-3-yl)carbamate.
| Compound Name | tert-butyl N-(1-hydroxy-2-methyl-1-phenylhept-6-yn-3-yl)carbamate |
|---|---|
| PubChem CID | 123595256 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | tert-butyl N-(1-hydroxy-2-methyl-1-phenylhept-6-yn-3-yl)carbamate |
| SMILES | C#CCCC(NC(=O)OC(C)(C)C)C(C)C(O)c1ccccc1 |
| InChI | InChI=1S/C19H27NO3/c1-6-7-13-16(20-18(22)23-19(3,4)5)14(2)17(21)15-11-9-8-10-12-15/h1,8-12,14,16-17,21H,7,13H2,2-5H3,(H,20,22) |
| InChIKey | ADYKFCOSMYRTJR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|