C18H26N2O2 — CID 101158096
tert-butyl N-[(1R,2S)-1-cyano-4-methyl-1-phenylpentan-2-yl]carbamate (PubChem CID 101158096) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S)-1-cyano-4-methyl-1-phenylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S)-1-cyano-4-methyl-1-phenylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 101158096 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | tert-butyl N-[(1R,2S)-1-cyano-4-methyl-1-phenylpentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)[C@H](C#N)c1ccccc1 |
| InChI | InChI=1S/C18H26N2O2/c1-13(2)11-16(20-17(21)22-18(3,4)5)15(12-19)14-9-7-6-8-10-14/h6-10,13,15-16H,11H2,1-5H3,(H,20,21)/t15-,16+/m1/s1 |
| InChIKey | AGHIGGHGIXFSPC-CVEARBPZSA-N |
| XLogP | 4.23 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |