C18H24N2O5 — CID 171482844
tert-butyl N-[(1R,2R)-1-carbamoyloxy-1-hydroxy-1-phenylhex-5-yn-2-yl]carbamate (PubChem CID 171482844) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-1-carbamoyloxy-1-hydroxy-1-phenylhex-5-yn-2-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R)-1-carbamoyloxy-1-hydroxy-1-phenylhex-5-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 171482844 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | tert-butyl N-[(1R,2R)-1-carbamoyloxy-1-hydroxy-1-phenylhex-5-yn-2-yl]carbamate |
| SMILES | C#CCC[C@@H](NC(=O)OC(C)(C)C)[C@](O)(OC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C18H24N2O5/c1-5-6-12-14(20-16(22)25-17(2,3)4)18(23,24-15(19)21)13-10-8-7-9-11-13/h1,7-11,14,23H,6,12H2,2-4H3,(H2,19,21)(H,20,22)/t14-,18-/m1/s1 |
| InChIKey | XJSMOSRSUVRWAG-RDTXWAMCSA-N |
| XLogP | 2.23 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|