About 2-phenylpropan-2-yl carbamate;propane
2-phenylpropan-2-yl carbamate;propane (PubChem CID 175117543) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-phenylpropan-2-yl carbamate;propane.
Molecular Properties
| Compound Name | 2-phenylpropan-2-yl carbamate;propane |
| PubChem CID | 175117543 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 2-phenylpropan-2-yl carbamate;propane |
| SMILES | CC(C)(OC(N)=O)c1ccccc1.CCC |
| InChI | InChI=1S/C10H13NO2.C3H8/c1-10(2,13-9(11)12)8-6-4-3-5-7-8;1-3-2/h3-7H,1-2H3,(H2,11,12);3H2,1-2H3 |
| InChIKey | GQTYQDXUEIFNIQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenylpropan-2-yl carbamate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpropan-2-yl carbamate;propane?
The IUPAC name of 2-phenylpropan-2-yl carbamate;propane (CID 175117543) is 2-phenylpropan-2-yl carbamate;propane.
What is the SMILES notation for 2-phenylpropan-2-yl carbamate;propane?
The canonical SMILES for 2-phenylpropan-2-yl carbamate;propane is CC(C)(OC(N)=O)c1ccccc1.CCC.
What is the InChIKey of 2-phenylpropan-2-yl carbamate;propane?
The InChIKey is GQTYQDXUEIFNIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2.C3H8/c1-10(2,13-9(11)12)8-6-4-3-5-7-8;1-3-2/h3-7H,1-2H3,(H2,11,12);3H2,1-2H3.
What are the key properties of 2-phenylpropan-2-yl carbamate;propane?
2-phenylpropan-2-yl carbamate;propane has a molecular weight of 223.32 g/mol, XLogP of 3.43, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpropan-2-yl carbamate;propane is sourced from PubChem (CID 175117543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).