About 2-phenylpropan-2-yl 3-[3-oxo-3-(2-phenylpropan-2-yloxy)propyl]sulfanylpropanoate
2-phenylpropan-2-yl 3-[3-oxo-3-(2-phenylpropan-2-yloxy)propyl]sulfanylpropanoate (PubChem CID 70006698) has the molecular formula C24H30O4S
and a molecular weight of 414.57 g/mol. Its IUPAC name is 2-phenylpropan-2-yl 3-[3-oxo-3-(2-phenylpropan-2-yloxy)propyl]sulfanylpropanoate.
Molecular Properties
| Compound Name | 2-phenylpropan-2-yl 3-[3-oxo-3-(2-phenylpropan-2-yloxy)propyl]sulfanylpropanoate |
| PubChem CID | 70006698 |
| Molecular Formula | C24H30O4S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 2-phenylpropan-2-yl 3-[3-oxo-3-(2-phenylpropan-2-yloxy)propyl]sulfanylpropanoate |
| SMILES | CC(C)(OC(=O)CCSCCC(=O)OC(C)(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H30O4S/c1-23(2,19-11-7-5-8-12-19)27-21(25)15-17-29-18-16-22(26)28-24(3,4)20-13-9-6-10-14-20/h5-14H,15-18H2,1-4H3 |
| InChIKey | OTQHXCLZPJMJCS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylpropan-2-yl 3-[3-oxo-3-(2-phenylpropan-2-yloxy)propyl]sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpropan-2-yl 3-[3-oxo-3-(2-phenylpropan-2-yloxy)propyl]sulfanylpropanoate?
The IUPAC name of 2-phenylpropan-2-yl 3-[3-oxo-3-(2-phenylpropan-2-yloxy)propyl]sulfanylpropanoate (CID 70006698) is 2-phenylpropan-2-yl 3-[3-oxo-3-(2-phenylpropan-2-yloxy)propyl]sulfanylpropanoate.
What is the SMILES notation for 2-phenylpropan-2-yl 3-[3-oxo-3-(2-phenylpropan-2-yloxy)propyl]sulfanylpropanoate?
The canonical SMILES for 2-phenylpropan-2-yl 3-[3-oxo-3-(2-phenylpropan-2-yloxy)propyl]sulfanylpropanoate is CC(C)(OC(=O)CCSCCC(=O)OC(C)(C)c1ccccc1)c1ccccc1.
What is the InChIKey of 2-phenylpropan-2-yl 3-[3-oxo-3-(2-phenylpropan-2-yloxy)propyl]sulfanylpropanoate?
The InChIKey is OTQHXCLZPJMJCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30O4S/c1-23(2,19-11-7-5-8-12-19)27-21(25)15-17-29-18-16-22(26)28-24(3,4)20-13-9-6-10-14-20/h5-14H,15-18H2,1-4H3.
What are the key properties of 2-phenylpropan-2-yl 3-[3-oxo-3-(2-phenylpropan-2-yloxy)propyl]sulfanylpropanoate?
2-phenylpropan-2-yl 3-[3-oxo-3-(2-phenylpropan-2-yloxy)propyl]sulfanylpropanoate has a molecular weight of 414.57 g/mol, XLogP of 5.46, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpropan-2-yl 3-[3-oxo-3-(2-phenylpropan-2-yloxy)propyl]sulfanylpropanoate is sourced from PubChem (CID 70006698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).