C37H37NO5S — CID 11801840
tert-butyl 3-[2-(1,3-dioxoisoindol-2-yl)-3-trityloxypropyl]sulfanylpropanoate (PubChem CID 11801840) has the molecular formula C37H37NO5S and a molecular weight of 607.77 g/mol. Its IUPAC name is tert-butyl 3-[2-(1,3-dioxoisoindol-2-yl)-3-trityloxypropyl]sulfanylpropanoate.
| Compound Name | tert-butyl 3-[2-(1,3-dioxoisoindol-2-yl)-3-trityloxypropyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 11801840 |
| Molecular Formula | C37H37NO5S |
| Molecular Weight | 607.77 g/mol |
| Exact Mass | 607.24 |
| IUPAC Name | tert-butyl 3-[2-(1,3-dioxoisoindol-2-yl)-3-trityloxypropyl]sulfanylpropanoate |
| SMILES | CC(C)(C)OC(=O)CCSCC(COC(c1ccccc1)(c1ccccc1)c1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C37H37NO5S/c1-36(2,3)43-33(39)23-24-44-26-30(38-34(40)31-21-13-14-22-32(31)35(38)41)25-42-37(27-15-7-4-8-16-27,28-17-9-5-10-18-28)29-19-11-6-12-20-29/h4-22,30H,23-26H2,1-3H3 |
| InChIKey | WIIDHRMXDPABNB-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.77 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|