C23H23NO4S2 — CID 170962043
tert-butyl 3-[2,5-dioxo-3,4-bis(phenylsulfanyl)pyrrol-1-yl]propanoate (PubChem CID 170962043) has the molecular formula C23H23NO4S2 and a molecular weight of 441.57 g/mol. Its IUPAC name is tert-butyl 3-[2,5-dioxo-3,4-bis(phenylsulfanyl)pyrrol-1-yl]propanoate.
| Compound Name | tert-butyl 3-[2,5-dioxo-3,4-bis(phenylsulfanyl)pyrrol-1-yl]propanoate |
|---|---|
| PubChem CID | 170962043 |
| Molecular Formula | C23H23NO4S2 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | tert-butyl 3-[2,5-dioxo-3,4-bis(phenylsulfanyl)pyrrol-1-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCN1C(=O)C(Sc2ccccc2)=C(Sc2ccccc2)C1=O |
| InChI | InChI=1S/C23H23NO4S2/c1-23(2,3)28-18(25)14-15-24-21(26)19(29-16-10-6-4-7-11-16)20(22(24)27)30-17-12-8-5-9-13-17/h4-13H,14-15H2,1-3H3 |
| InChIKey | QYERRTDBSLZNPV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|