C16H19NO4 — CID 116662664
tert-butyl 3-(7-methyl-2,3-dioxoindol-1-yl)propanoate (PubChem CID 116662664) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is tert-butyl 3-(7-methyl-2,3-dioxoindol-1-yl)propanoate.
| Compound Name | tert-butyl 3-(7-methyl-2,3-dioxoindol-1-yl)propanoate |
|---|---|
| PubChem CID | 116662664 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | tert-butyl 3-(7-methyl-2,3-dioxoindol-1-yl)propanoate |
| SMILES | Cc1cccc2c1N(CCC(=O)OC(C)(C)C)C(=O)C2=O |
| InChI | InChI=1S/C16H19NO4/c1-10-6-5-7-11-13(10)17(15(20)14(11)19)9-8-12(18)21-16(2,3)4/h5-7H,8-9H2,1-4H3 |
| InChIKey | KJIKVUAPKFBJNJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|