3-(7-methyl-2,3-dioxoindol-1-yl)propanoic acid

C12H11NO4 — CID 61146875

IUPAC3-(7-methyl-2,3-dioxoindol-1-yl)propanoic acid
SMILESCc1cccc2c1N(CCC(=O)O)C(=O)C2=O
InChIInChI=1S/C12H11NO4/c1-7-3-2-4-8-10(7)13(6-5-9(14)15)12(17)11(8)16/h2-4H,5-6H2,1H3,(H,14,15)
InChIKeyYLOKWALKXBMOMA-UHFFFAOYSA-N
MW233.22 g/mol
LogP1.00
Rot. Bonds3

About 3-(7-methyl-2,3-dioxoindol-1-yl)propanoic acid

3-(7-methyl-2,3-dioxoindol-1-yl)propanoic acid (PubChem CID 61146875) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 3-(7-methyl-2,3-dioxoindol-1-yl)propanoic acid.

Molecular Properties

Compound Name3-(7-methyl-2,3-dioxoindol-1-yl)propanoic acid
PubChem CID61146875
Molecular FormulaC12H11NO4
Molecular Weight233.22 g/mol
Exact Mass233.07
IUPAC Name3-(7-methyl-2,3-dioxoindol-1-yl)propanoic acid
SMILESCc1cccc2c1N(CCC(=O)O)C(=O)C2=O
InChIInChI=1S/C12H11NO4/c1-7-3-2-4-8-10(7)13(6-5-9(14)15)12(17)11(8)16/h2-4H,5-6H2,1H3,(H,14,15)
InChIKeyYLOKWALKXBMOMA-UHFFFAOYSA-N
XLogP1.00
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.22
LogP ≤ 51.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 3-(7-methyl-2,3-dioxoindol-1-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(7-methyl-2,3-dioxoindol-1-yl)propanoic acid?
The IUPAC name of 3-(7-methyl-2,3-dioxoindol-1-yl)propanoic acid (CID 61146875) is 3-(7-methyl-2,3-dioxoindol-1-yl)propanoic acid.
What is the SMILES notation for 3-(7-methyl-2,3-dioxoindol-1-yl)propanoic acid?
The canonical SMILES for 3-(7-methyl-2,3-dioxoindol-1-yl)propanoic acid is Cc1cccc2c1N(CCC(=O)O)C(=O)C2=O.
What is the InChIKey of 3-(7-methyl-2,3-dioxoindol-1-yl)propanoic acid?
The InChIKey is YLOKWALKXBMOMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO4/c1-7-3-2-4-8-10(7)13(6-5-9(14)15)12(17)11(8)16/h2-4H,5-6H2,1H3,(H,14,15).
What are the key properties of 3-(7-methyl-2,3-dioxoindol-1-yl)propanoic acid?
3-(7-methyl-2,3-dioxoindol-1-yl)propanoic acid has a molecular weight of 233.22 g/mol, XLogP of 1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(7-methyl-2,3-dioxoindol-1-yl)propanoic acid is sourced from PubChem (CID 61146875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).