C15H19NO3 — CID 107704083
1-(6-hydroxyhexyl)-7-methylindole-2,3-dione (PubChem CID 107704083) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 1-(6-hydroxyhexyl)-7-methylindole-2,3-dione.
| Compound Name | 1-(6-hydroxyhexyl)-7-methylindole-2,3-dione |
|---|---|
| PubChem CID | 107704083 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 1-(6-hydroxyhexyl)-7-methylindole-2,3-dione |
| SMILES | Cc1cccc2c1N(CCCCCCO)C(=O)C2=O |
| InChI | InChI=1S/C15H19NO3/c1-11-7-6-8-12-13(11)16(15(19)14(12)18)9-4-2-3-5-10-17/h6-8,17H,2-5,9-10H2,1H3 |
| InChIKey | QDUPXFJIUGPDAE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|