C12H14N2O2 — CID 84622799
1-(3-aminopropyl)-7-methylindole-2,3-dione (PubChem CID 84622799) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-(3-aminopropyl)-7-methylindole-2,3-dione.
| Compound Name | 1-(3-aminopropyl)-7-methylindole-2,3-dione |
|---|---|
| PubChem CID | 84622799 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-(3-aminopropyl)-7-methylindole-2,3-dione |
| SMILES | Cc1cccc2c1N(CCCN)C(=O)C2=O |
| InChI | InChI=1S/C12H14N2O2/c1-8-4-2-5-9-10(8)14(7-3-6-13)12(16)11(9)15/h2,4-5H,3,6-7,13H2,1H3 |
| InChIKey | NCSOCNKWAWWPHN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|