C12H10ClNO4 — CID 84640537
3-(6-chloro-7-methyl-2,3-dioxoindol-1-yl)propanoic acid (PubChem CID 84640537) has the molecular formula C12H10ClNO4 and a molecular weight of 267.67 g/mol. Its IUPAC name is 3-(6-chloro-7-methyl-2,3-dioxoindol-1-yl)propanoic acid.
| Compound Name | 3-(6-chloro-7-methyl-2,3-dioxoindol-1-yl)propanoic acid |
|---|---|
| PubChem CID | 84640537 |
| Molecular Formula | C12H10ClNO4 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 3-(6-chloro-7-methyl-2,3-dioxoindol-1-yl)propanoic acid |
| SMILES | Cc1c(Cl)ccc2c1N(CCC(=O)O)C(=O)C2=O |
| InChI | InChI=1S/C12H10ClNO4/c1-6-8(13)3-2-7-10(6)14(5-4-9(15)16)12(18)11(7)17/h2-3H,4-5H2,1H3,(H,15,16) |
| InChIKey | XOTDVHHAHWRHER-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|