C13H14ClNO2 — CID 20502556
1-(3-chloropropyl)-6,7-dimethylindole-2,3-dione (PubChem CID 20502556) has the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. Its IUPAC name is 1-(3-chloropropyl)-6,7-dimethylindole-2,3-dione.
| Compound Name | 1-(3-chloropropyl)-6,7-dimethylindole-2,3-dione |
|---|---|
| PubChem CID | 20502556 |
| Molecular Formula | C13H14ClNO2 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 1-(3-chloropropyl)-6,7-dimethylindole-2,3-dione |
| SMILES | Cc1ccc2c(c1C)N(CCCCl)C(=O)C2=O |
| InChI | InChI=1S/C13H14ClNO2/c1-8-4-5-10-11(9(8)2)15(7-3-6-14)13(17)12(10)16/h4-5H,3,6-7H2,1-2H3 |
| InChIKey | YACYWJXMGPRFBI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|