C14H17NO5S — CID 115597534
tert-butyl 3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoate (PubChem CID 115597534) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is tert-butyl 3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoate.
| Compound Name | tert-butyl 3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoate |
|---|---|
| PubChem CID | 115597534 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | tert-butyl 3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoate |
| SMILES | CC(C)(C)OC(=O)CCN1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C14H17NO5S/c1-14(2,3)20-12(16)8-9-15-13(17)10-6-4-5-7-11(10)21(15,18)19/h4-7H,8-9H2,1-3H3 |
| InChIKey | KIIVPDVPLFTZLH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |