C13H16N2O3S2 — CID 65248646
2,2-dimethyl-4-(1,1,3-trioxo-1,2-benzothiazol-2-yl)butanethioamide (PubChem CID 65248646) has the molecular formula C13H16N2O3S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 2,2-dimethyl-4-(1,1,3-trioxo-1,2-benzothiazol-2-yl)butanethioamide.
| Compound Name | 2,2-dimethyl-4-(1,1,3-trioxo-1,2-benzothiazol-2-yl)butanethioamide |
|---|---|
| PubChem CID | 65248646 |
| Molecular Formula | C13H16N2O3S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 2,2-dimethyl-4-(1,1,3-trioxo-1,2-benzothiazol-2-yl)butanethioamide |
| SMILES | CC(C)(CCN1C(=O)c2ccccc2S1(=O)=O)C(N)=S |
| InChI | InChI=1S/C13H16N2O3S2/c1-13(2,12(14)19)7-8-15-11(16)9-5-3-4-6-10(9)20(15,17)18/h3-6H,7-8H2,1-2H3,(H2,14,19) |
| InChIKey | SBONWLOGFSPUFZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|