C12H13NO5S — CID 691185
ethyl 3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoate (PubChem CID 691185) has the molecular formula C12H13NO5S and a molecular weight of 283.31 g/mol. Its IUPAC name is ethyl 3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoate.
| Compound Name | ethyl 3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoate |
|---|---|
| PubChem CID | 691185 |
| Molecular Formula | C12H13NO5S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | ethyl 3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoate |
| SMILES | CCOC(=O)CCN1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C12H13NO5S/c1-2-18-11(14)7-8-13-12(15)9-5-3-4-6-10(9)19(13,16)17/h3-6H,2,7-8H2,1H3 |
| InChIKey | XRHNRZAAXVKGNS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |