C11H14N2O3S — CID 117030066
2-(3-aminobutyl)-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 117030066) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-(3-aminobutyl)-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-(3-aminobutyl)-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 117030066 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-(3-aminobutyl)-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | CC(N)CCN1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C11H14N2O3S/c1-8(12)6-7-13-11(14)9-4-2-3-5-10(9)17(13,15)16/h2-5,8H,6-7,12H2,1H3 |
| InChIKey | KGADZYLWXIGDTQ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |