C13H17NO5S — CID 63630263
2-(2,2-diethoxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 63630263) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-(2,2-diethoxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-(2,2-diethoxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 63630263 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-(2,2-diethoxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | CCOC(CN1C(=O)c2ccccc2S1(=O)=O)OCC |
| InChI | InChI=1S/C13H17NO5S/c1-3-18-12(19-4-2)9-14-13(15)10-7-5-6-8-11(10)20(14,16)17/h5-8,12H,3-4,9H2,1-2H3 |
| InChIKey | PUOQSVFIXYWPOG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|