C8H8N2O3S — CID 54531950
2-(aminomethyl)-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 54531950) has the molecular formula C8H8N2O3S and a molecular weight of 212.23 g/mol. Its IUPAC name is 2-(aminomethyl)-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-(aminomethyl)-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 54531950 |
| Molecular Formula | C8H8N2O3S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 2-(aminomethyl)-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | NCN1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C8H8N2O3S/c9-5-10-8(11)6-3-1-2-4-7(6)14(10,12)13/h1-4H,5,9H2 |
| InChIKey | YXDZWDPQVWRKBU-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |