C12H17NO3SSi — CID 54112946
1,1-dioxo-2-(2-trimethylsilylethyl)-1,2-benzothiazol-3-one (PubChem CID 54112946) has the molecular formula C12H17NO3SSi and a molecular weight of 283.42 g/mol. Its IUPAC name is 1,1-dioxo-2-(2-trimethylsilylethyl)-1,2-benzothiazol-3-one.
| Compound Name | 1,1-dioxo-2-(2-trimethylsilylethyl)-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 54112946 |
| Molecular Formula | C12H17NO3SSi |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 1,1-dioxo-2-(2-trimethylsilylethyl)-1,2-benzothiazol-3-one |
| SMILES | C[Si](C)(C)CCN1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C12H17NO3SSi/c1-18(2,3)9-8-13-12(14)10-6-4-5-7-11(10)17(13,15)16/h4-7H,8-9H2,1-3H3 |
| InChIKey | NIIUOWMRLBGYAG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|