C13H16BrNO3S — CID 10736333
2-(6-bromohexyl)-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 10736333) has the molecular formula C13H16BrNO3S and a molecular weight of 346.25 g/mol. Its IUPAC name is 2-(6-bromohexyl)-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-(6-bromohexyl)-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 10736333 |
| Molecular Formula | C13H16BrNO3S |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 2-(6-bromohexyl)-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | O=C1c2ccccc2S(=O)(=O)N1CCCCCCBr |
| InChI | InChI=1S/C13H16BrNO3S/c14-9-5-1-2-6-10-15-13(16)11-7-3-4-8-12(11)19(15,17)18/h3-4,7-8H,1-2,5-6,9-10H2 |
| InChIKey | UIDYGIZHUADHJH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|