C18H19NO4S — CID 25018867
2-[4-(3-methylphenoxy)butyl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 25018867) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is 2-[4-(3-methylphenoxy)butyl]-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-[4-(3-methylphenoxy)butyl]-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 25018867 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2-[4-(3-methylphenoxy)butyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | Cc1cccc(OCCCCN2C(=O)c3ccccc3S2(=O)=O)c1 |
| InChI | InChI=1S/C18H19NO4S/c1-14-7-6-8-15(13-14)23-12-5-4-11-19-18(20)16-9-2-3-10-17(16)24(19,21)22/h2-3,6-10,13H,4-5,11-12H2,1H3 |
| InChIKey | FHUDXVSJUKKFDN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|