C18H19N3O5S — CID 75401858
N-[2-(3-methylphenoxy)ethyl]-2-(1,1,4-trioxo-2H-1λ6,2,3-benzothiadiazin-3-yl)acetamide (PubChem CID 75401858) has the molecular formula C18H19N3O5S and a molecular weight of 389.43 g/mol. Its IUPAC name is N-[2-(3-methylphenoxy)ethyl]-2-(1,1,4-trioxo-2H-1λ6,2,3-benzothiadiazin-3-yl)acetamide.
| Compound Name | N-[2-(3-methylphenoxy)ethyl]-2-(1,1,4-trioxo-2H-1λ6,2,3-benzothiadiazin-3-yl)acetamide |
|---|---|
| PubChem CID | 75401858 |
| Molecular Formula | C18H19N3O5S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | N-[2-(3-methylphenoxy)ethyl]-2-(1,1,4-trioxo-2H-1λ6,2,3-benzothiadiazin-3-yl)acetamide |
| SMILES | Cc1cccc(OCCNC(=O)CN2NS(=O)(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C18H19N3O5S/c1-13-5-4-6-14(11-13)26-10-9-19-17(22)12-21-18(23)15-7-2-3-8-16(15)27(24,25)20-21/h2-8,11,20H,9-10,12H2,1H3,(H,19,22) |
| InChIKey | HYLBWDWOYMPYSY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|