C21H26N2O3 — CID 19830935
N-methylmethanamine;2-[4-(3-methylphenoxy)butyl]isoindole-1,3-dione (PubChem CID 19830935) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-methylmethanamine;2-[4-(3-methylphenoxy)butyl]isoindole-1,3-dione.
| Compound Name | N-methylmethanamine;2-[4-(3-methylphenoxy)butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 19830935 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-methylmethanamine;2-[4-(3-methylphenoxy)butyl]isoindole-1,3-dione |
| SMILES | CNC.Cc1cccc(OCCCCN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C19H19NO3.C2H7N/c1-14-7-6-8-15(13-14)23-12-5-4-11-20-18(21)16-9-2-3-10-17(16)19(20)22;1-3-2/h2-3,6-10,13H,4-5,11-12H2,1H3;3H,1-2H3 |
| InChIKey | SWKNKIDAEZIYHJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|