C23H25F2NO3 — CID 67246592
2-[6-[2,2-difluoro-2-(3-methylphenyl)ethoxy]hexyl]isoindole-1,3-dione (PubChem CID 67246592) has the molecular formula C23H25F2NO3 and a molecular weight of 401.45 g/mol. Its IUPAC name is 2-[6-[2,2-difluoro-2-(3-methylphenyl)ethoxy]hexyl]isoindole-1,3-dione.
| Compound Name | 2-[6-[2,2-difluoro-2-(3-methylphenyl)ethoxy]hexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67246592 |
| Molecular Formula | C23H25F2NO3 |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 2-[6-[2,2-difluoro-2-(3-methylphenyl)ethoxy]hexyl]isoindole-1,3-dione |
| SMILES | Cc1cccc(C(F)(F)COCCCCCCN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C23H25F2NO3/c1-17-9-8-10-18(15-17)23(24,25)16-29-14-7-3-2-6-13-26-21(27)19-11-4-5-12-20(19)22(26)28/h4-5,8-12,15H,2-3,6-7,13-14,16H2,1H3 |
| InChIKey | BWQXZDNXJUGYQU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|