C30H33NO3 — CID 21281146
2-[6-[4-(2,6-dimethylphenyl)-3,5-dimethylphenoxy]hexyl]isoindole-1,3-dione (PubChem CID 21281146) has the molecular formula C30H33NO3 and a molecular weight of 455.60 g/mol. Its IUPAC name is 2-[6-[4-(2,6-dimethylphenyl)-3,5-dimethylphenoxy]hexyl]isoindole-1,3-dione.
| Compound Name | 2-[6-[4-(2,6-dimethylphenyl)-3,5-dimethylphenoxy]hexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 21281146 |
| Molecular Formula | C30H33NO3 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 2-[6-[4-(2,6-dimethylphenyl)-3,5-dimethylphenoxy]hexyl]isoindole-1,3-dione |
| SMILES | Cc1cccc(C)c1-c1c(C)cc(OCCCCCCN2C(=O)c3ccccc3C2=O)cc1C |
| InChI | InChI=1S/C30H33NO3/c1-20-12-11-13-21(2)27(20)28-22(3)18-24(19-23(28)4)34-17-10-6-5-9-16-31-29(32)25-14-7-8-15-26(25)30(31)33/h7-8,11-15,18-19H,5-6,9-10,16-17H2,1-4H3 |
| InChIKey | XLATXSQUZMFGAC-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|