C20H17NO3 — CID 155919873
2-[4-(3-ethynylphenoxy)butyl]isoindole-1,3-dione (PubChem CID 155919873) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is 2-[4-(3-ethynylphenoxy)butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(3-ethynylphenoxy)butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 155919873 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-[4-(3-ethynylphenoxy)butyl]isoindole-1,3-dione |
| SMILES | C#Cc1cccc(OCCCCN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C20H17NO3/c1-2-15-8-7-9-16(14-15)24-13-6-5-12-21-19(22)17-10-3-4-11-18(17)20(21)23/h1,3-4,7-11,14H,5-6,12-13H2 |
| InChIKey | MVUGQPNGBGDVKR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|