C20H21NO5 — CID 86019288
2-[4-[3,5-bis(hydroxymethyl)phenoxy]butyl]isoindole-1,3-dione (PubChem CID 86019288) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-[4-[3,5-bis(hydroxymethyl)phenoxy]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[3,5-bis(hydroxymethyl)phenoxy]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 86019288 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-[4-[3,5-bis(hydroxymethyl)phenoxy]butyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCOc1cc(CO)cc(CO)c1 |
| InChI | InChI=1S/C20H21NO5/c22-12-14-9-15(13-23)11-16(10-14)26-8-4-3-7-21-19(24)17-5-1-2-6-18(17)20(21)25/h1-2,5-6,9-11,22-23H,3-4,7-8,12-13H2 |
| InChIKey | IAFYCKVNSHCQQX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|