C20H21NO4 — CID 11515611
2-[3-[4-(3-hydroxypropyl)phenoxy]propyl]isoindole-1,3-dione (PubChem CID 11515611) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-[3-[4-(3-hydroxypropyl)phenoxy]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-(3-hydroxypropyl)phenoxy]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11515611 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-[3-[4-(3-hydroxypropyl)phenoxy]propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCOc1ccc(CCCO)cc1 |
| InChI | InChI=1S/C20H21NO4/c22-13-3-5-15-8-10-16(11-9-15)25-14-4-12-21-19(23)17-6-1-2-7-18(17)20(21)24/h1-2,6-11,22H,3-5,12-14H2 |
| InChIKey | YQRGYMADZXEYHY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|