C21H22N2O3 — CID 118759856
2-[3-[4-[(cyclopropylamino)methyl]phenoxy]propyl]isoindole-1,3-dione (PubChem CID 118759856) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-[3-[4-[(cyclopropylamino)methyl]phenoxy]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-[(cyclopropylamino)methyl]phenoxy]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118759856 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 2-[3-[4-[(cyclopropylamino)methyl]phenoxy]propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCOc1ccc(CNC2CC2)cc1 |
| InChI | InChI=1S/C21H22N2O3/c24-20-18-4-1-2-5-19(18)21(25)23(20)12-3-13-26-17-10-6-15(7-11-17)14-22-16-8-9-16/h1-2,4-7,10-11,16,22H,3,8-9,12-14H2 |
| InChIKey | UWJUESFAZYPLKF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|