C22H20N2O8 — CID 45377045
(2R)-3-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-2-(oxaloamino)propanoic acid (PubChem CID 45377045) has the molecular formula C22H20N2O8 and a molecular weight of 440.41 g/mol. Its IUPAC name is (2R)-3-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-2-(oxaloamino)propanoic acid.
| Compound Name | (2R)-3-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-2-(oxaloamino)propanoic acid |
|---|---|
| PubChem CID | 45377045 |
| Molecular Formula | C22H20N2O8 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | (2R)-3-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-2-(oxaloamino)propanoic acid |
| SMILES | O=C(O)C(=O)N[C@H](Cc1ccc(OCCCN2C(=O)c3ccccc3C2=O)cc1)C(=O)O |
| InChI | InChI=1S/C22H20N2O8/c25-18(22(30)31)23-17(21(28)29)12-13-6-8-14(9-7-13)32-11-3-10-24-19(26)15-4-1-2-5-16(15)20(24)27/h1-2,4-9,17H,3,10-12H2,(H,23,25)(H,28,29)(H,30,31)/t17-/m1/s1 |
| InChIKey | OPZUVYWAOXCPBR-QGZVFWFLSA-N |
| XLogP | 0.95 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|