C27H33N3O7S — CID 70080057
(2S)-2-[[(2S)-2-[4-(1,3-dioxoisoindol-2-yl)butylsulfonylamino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid (PubChem CID 70080057) has the molecular formula C27H33N3O7S and a molecular weight of 543.64 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[4-(1,3-dioxoisoindol-2-yl)butylsulfonylamino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[4-(1,3-dioxoisoindol-2-yl)butylsulfonylamino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 70080057 |
| Molecular Formula | C27H33N3O7S |
| Molecular Weight | 543.64 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | (2S)-2-[[(2S)-2-[4-(1,3-dioxoisoindol-2-yl)butylsulfonylamino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)C[C@H](NS(=O)(=O)CCCCN1C(=O)c2ccccc2C1=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H33N3O7S/c1-18(2)16-22(24(31)28-23(27(34)35)17-19-10-4-3-5-11-19)29-38(36,37)15-9-8-14-30-25(32)20-12-6-7-13-21(20)26(30)33/h3-7,10-13,18,22-23,29H,8-9,14-17H2,1-2H3,(H,28,31)(H,34,35)/t22-,23-/m0/s1 |
| InChIKey | OZJUOKSRQTUBAJ-GOTSBHOMSA-N |
| XLogP | 2.21 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.64 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|