C19H31N3O5S — CID 139797469
(2S)-2-[[(2S)-2-(4-aminobutylsulfonylamino)-4-methylpentanoyl]amino]-3-phenylpropanoic acid (PubChem CID 139797469) has the molecular formula C19H31N3O5S and a molecular weight of 413.54 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(4-aminobutylsulfonylamino)-4-methylpentanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-(4-aminobutylsulfonylamino)-4-methylpentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 139797469 |
| Molecular Formula | C19H31N3O5S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (2S)-2-[[(2S)-2-(4-aminobutylsulfonylamino)-4-methylpentanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)C[C@H](NS(=O)(=O)CCCCN)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H31N3O5S/c1-14(2)12-16(22-28(26,27)11-7-6-10-20)18(23)21-17(19(24)25)13-15-8-4-3-5-9-15/h3-5,8-9,14,16-17,22H,6-7,10-13,20H2,1-2H3,(H,21,23)(H,24,25)/t16-,17-/m0/s1 |
| InChIKey | BZWIJFHTFYSHSX-IRXDYDNUSA-N |
| XLogP | 0.87 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|