C19H32N3O5P — CID 54074382
(2S)-2-[[(2S)-2-[[4-aminobutyl(hydroxy)phosphoryl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid (PubChem CID 54074382) has the molecular formula C19H32N3O5P and a molecular weight of 413.46 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[4-aminobutyl(hydroxy)phosphoryl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[4-aminobutyl(hydroxy)phosphoryl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 54074382 |
| Molecular Formula | C19H32N3O5P |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[4-aminobutyl(hydroxy)phosphoryl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NP(=O)(O)CCCCN)C(=O)O |
| InChI | InChI=1S/C19H32N3O5P/c1-14(2)12-17(19(24)25)21-18(23)16(13-15-8-4-3-5-9-15)22-28(26,27)11-7-6-10-20/h3-5,8-9,14,16-17H,6-7,10-13,20H2,1-2H3,(H,21,23)(H,24,25)(H2,22,26,27)/t16-,17-/m0/s1 |
| InChIKey | MIQVNLSWTZJHKM-IRXDYDNUSA-N |
| XLogP | 1.73 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|