C21H35N4O7P — CID 137348719
(2S)-6-amino-2-[[(2S)-2-[[hydroxy(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]-4-methylpentanoyl]amino]hexanoic acid (PubChem CID 137348719) has the molecular formula C21H35N4O7P and a molecular weight of 486.51 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[hydroxy(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]-4-methylpentanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[hydroxy(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]-4-methylpentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 137348719 |
| Molecular Formula | C21H35N4O7P |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[hydroxy(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]-4-methylpentanoyl]amino]hexanoic acid |
| SMILES | CC(C)C[C@H](NP(=O)(O)CNC(=O)OCc1ccccc1)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C21H35N4O7P/c1-15(2)12-18(19(26)24-17(20(27)28)10-6-7-11-22)25-33(30,31)14-23-21(29)32-13-16-8-4-3-5-9-16/h3-5,8-9,15,17-18H,6-7,10-14,22H2,1-2H3,(H,23,29)(H,24,26)(H,27,28)(H2,25,30,31)/t17-,18-/m0/s1 |
| InChIKey | QNYUXDGTIPHQBZ-ROUUACIJSA-N |
| XLogP | 1.76 |
| TPSA | 180.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|