C21H32N3O7P-2 — CID 175683415
(2S)-2-[[(2S)-4-methyl-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]pentanoyl]amino]hexanoate (PubChem CID 175683415) has the molecular formula C21H32N3O7P-2 and a molecular weight of 469.48 g/mol. Its IUPAC name is (2S)-2-[[(2S)-4-methyl-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]pentanoyl]amino]hexanoate.
| Compound Name | (2S)-2-[[(2S)-4-methyl-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]pentanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 175683415 |
| Molecular Formula | C21H32N3O7P-2 |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | (2S)-2-[[(2S)-4-methyl-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]pentanoyl]amino]hexanoate |
| SMILES | CCCC[C@H](NC(=O)[C@H](CC(C)C)NP(=O)([O-])CNC(=O)OCc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C21H34N3O7P/c1-4-5-11-17(20(26)27)23-19(25)18(12-15(2)3)24-32(29,30)14-22-21(28)31-13-16-9-7-6-8-10-16/h6-10,15,17-18H,4-5,11-14H2,1-3H3,(H,22,28)(H,23,25)(H,26,27)(H2,24,29,30)/p-2/t17-,18-/m0/s1 |
| InChIKey | OQXKTCJRFKXWNO-ROUUACIJSA-L |
| XLogP | 0.85 |
| TPSA | 159.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|