C23H31LiN3O5P — CID 118731679
lithium [[(2S)-4-methyl-1-oxo-1-(2-phenylethylamino)pentan-2-yl]amino]-(phenylmethoxycarbonylaminomethyl)phosphinate (PubChem CID 118731679) has the molecular formula C23H31LiN3O5P and a molecular weight of 467.43 g/mol. Its IUPAC name is lithium [[(2S)-4-methyl-1-oxo-1-(2-phenylethylamino)pentan-2-yl]amino]-(phenylmethoxycarbonylaminomethyl)phosphinate.
| Compound Name | lithium [[(2S)-4-methyl-1-oxo-1-(2-phenylethylamino)pentan-2-yl]amino]-(phenylmethoxycarbonylaminomethyl)phosphinate |
|---|---|
| PubChem CID | 118731679 |
| Molecular Formula | C23H31LiN3O5P |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | lithium [[(2S)-4-methyl-1-oxo-1-(2-phenylethylamino)pentan-2-yl]amino]-(phenylmethoxycarbonylaminomethyl)phosphinate |
| SMILES | CC(C)C[C@H](NP(=O)([O-])CNC(=O)OCc1ccccc1)C(=O)NCCc1ccccc1.[Li+] |
| InChI | InChI=1S/C23H32N3O5P.Li/c1-18(2)15-21(22(27)24-14-13-19-9-5-3-6-10-19)26-32(29,30)17-25-23(28)31-16-20-11-7-4-8-12-20;/h3-12,18,21H,13-17H2,1-2H3,(H,24,27)(H,25,28)(H2,26,29,30);/q;+1/p-1/t21-;/m0./s1 |
| InChIKey | OWUAZJJMGXKFDL-BOXHHOBZSA-M |
| XLogP | -0.21 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|