C18H26Li2N3O7P — CID 71458969
dilithium;(2S)-2-[[(2S)-4-methyl-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]pentanoyl]amino]propanoate (PubChem CID 71458969) has the molecular formula C18H26Li2N3O7P and a molecular weight of 441.28 g/mol. Its IUPAC name is dilithium;(2S)-2-[[(2S)-4-methyl-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]pentanoyl]amino]propanoate.
| Compound Name | dilithium;(2S)-2-[[(2S)-4-methyl-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]pentanoyl]amino]propanoate |
|---|---|
| PubChem CID | 71458969 |
| Molecular Formula | C18H26Li2N3O7P |
| Molecular Weight | 441.28 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | dilithium;(2S)-2-[[(2S)-4-methyl-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]pentanoyl]amino]propanoate |
| SMILES | CC(C)C[C@H](NP(=O)([O-])CNC(=O)OCc1ccccc1)C(=O)N[C@@H](C)C(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C18H28N3O7P.2Li/c1-12(2)9-15(16(22)20-13(3)17(23)24)21-29(26,27)11-19-18(25)28-10-14-7-5-4-6-8-14;;/h4-8,12-13,15H,9-11H2,1-3H3,(H,19,25)(H,20,22)(H,23,24)(H2,21,26,27);;/q;2*+1/p-2/t13-,15-;;/m0../s1 |
| InChIKey | JEJIDCONEDUUDP-USQKXAEFSA-L |
| XLogP | -6.31 |
| TPSA | 159.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.28 |
| LogP ≤ 5 | -6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|