C20H33LiN3O5P — CID 118731672
lithium [[(2S)-4-methyl-1-oxo-1-(pentylamino)pentan-2-yl]amino]-(phenylmethoxycarbonylaminomethyl)phosphinate (PubChem CID 118731672) has the molecular formula C20H33LiN3O5P and a molecular weight of 433.42 g/mol. Its IUPAC name is lithium [[(2S)-4-methyl-1-oxo-1-(pentylamino)pentan-2-yl]amino]-(phenylmethoxycarbonylaminomethyl)phosphinate.
| Compound Name | lithium [[(2S)-4-methyl-1-oxo-1-(pentylamino)pentan-2-yl]amino]-(phenylmethoxycarbonylaminomethyl)phosphinate |
|---|---|
| PubChem CID | 118731672 |
| Molecular Formula | C20H33LiN3O5P |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | lithium [[(2S)-4-methyl-1-oxo-1-(pentylamino)pentan-2-yl]amino]-(phenylmethoxycarbonylaminomethyl)phosphinate |
| SMILES | CCCCCNC(=O)[C@H](CC(C)C)NP(=O)([O-])CNC(=O)OCc1ccccc1.[Li+] |
| InChI | InChI=1S/C20H34N3O5P.Li/c1-4-5-9-12-21-19(24)18(13-16(2)3)23-29(26,27)15-22-20(25)28-14-17-10-7-6-8-11-17;/h6-8,10-11,16,18H,4-5,9,12-15H2,1-3H3,(H,21,24)(H,22,25)(H2,23,26,27);/q;+1/p-1/t18-;/m0./s1 |
| InChIKey | OXNWZXYOVNGMTM-FERBBOLQSA-M |
| XLogP | -0.26 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|